BIBW2992 (Afatinib) 10mM * 1mL in DMSO
BIBW2992 (Afatinib) is tyrosine kinase inhibitor (TKI) that irreversibly inhibits human epidermal growth factor receptor 2 (Her2) and epidermal growth factor receptor (EGFR) kinases.
| Trivial name | BIBW2992 (Afatinib) 10mM * 1mL in DMSO |
| Catalog Number | A10141-10mM-D |
| Alternative Name(s) | N-[4-[(3-Chloro-4-fluorophenyl)amino]-7-[[(3S)-tetrahydro-3-furanyl]oxy]-6-quinazolinyl]-4(dimethylamino)-2-butenamide |
| Molecular Formula | C24H25ClFN5O3 |
| CAS# | 439081-18-2 |
| SMILES | CN(C)C/C=C/C(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)O[C@H]4CCOC4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/bibw2992-afatinib.html |