BIBR 1532 10mM * 1mL in DMSO
BIBR 1532 is a selective telomerase inhibitor (IC50 values are 93, > 100000 and > 100000 nM for human telomerase, human RNA polymerase I and human RNA polymerase II + III respectively).
| Trivial name | BIBR 1532 10mM * 1mL in DMSO |
| Catalog Number | A10140-10mM-D |
| Alternative Name(s) | 2-[[(2E)-3-(2-Naphthalenyl)-1-oxo-2 -butenyl1-yl]amino]benzoic acid |
| Molecular Formula | C21H17NO3 |
| CAS# | 321674-73-1 |
| SMILES | C/C(=CC(=O)NC1=CC=CC=C1C(=O)O)/C2=CC3=CC=CC=C3C=C2 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/bibr-1532.html |
