Bendamustine Hydrochloride 50mg
Bendamustine Hydrochloride is a small molecule bifunctional DNA alkylating agent, combining a nitrogen mustard functionality with a purine-analog structure. The dense DNA-damaging functionality of Bendamustine differentiates it from other compounds used as antiproliferative agents, and these functionalities are thought to promote cell death through a variety of different pathways including apoptosis and mitotic catastrophe.
| Trivial name | Bendamustine Hydrochloride 50mg |
| Catalog Number | A10124-50 |
| Alternative Name(s) | 4-[5-[Bis(2-chloroethyl)amino]-1-methylbenzimidazol-2-yl]butanoic acid hydrochloride |
| Molecular Formula | C16H21Cl2N3O2.HCl |
| CAS# | 3543-75-7 |
| SMILES | CN1C2=C(C=C(C=C2)N(CCCl)CCCl)N=C1CCCC(=O)O.Cl |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/bendamustine-hydrochloride.html |
