Baicalein 50mg
Baicalein is a flavonoid originally isolated from the roots of Scutellaria baicalensis Georgi. Baicalein inhibits lipid peroxidation, as assessed by production of TBARS, with an IC50 value of 5 µM.
| Trivial name | Baicalein 50mg | 
| Catalog Number | A10120-50 | 
| Alternative Name(s) | 5,?€?6,?€?7-?€?trihydroxyflavone | 
| Molecular Formula | C15H10O5 | 
| CAS# | 491-67-8 | 
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)O)O)O | 
| Size | 50mg | 
| Supplier Page | http://www.adooq.com/baicalein.html | 
 
                    