Baicalein 100mg
Baicalein is a flavonoid originally isolated from the roots of Scutellaria baicalensis Georgi. Baicalein inhibits lipid peroxidation, as assessed by production of TBARS, with an IC50 value of 5 µM.
| Trivial name | Baicalein 100mg |
| Catalog Number | A10120-100 |
| Alternative Name(s) | 5,?€?6,?€?7-?€?trihydroxyflavone |
| Molecular Formula | C15H10O5 |
| CAS# | 491-67-8 |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)O)O)O |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/baicalein.html |
