AZD8330 10mM * 1mL in DMSO
AZD8330 is a MEK inhibitor that specifically inhibits mitogen-activated protein kinase kinase 1 (MEK or MAP/ERK kinase1), resulting in inhibition of growth factor-mediated cell signaling and tumor cell proliferation.
| Trivial name | AZD8330 10mM * 1mL in DMSO |
| Catalog Number | A10115-10mM-D |
| Alternative Name(s) | 2-(2-Fluoro-4-iodophenylamino)-N-(2-hydroxyethoxy)-1,5-dimethyl-6-oxo-1,6-dihydropyridine-3-carboxamide |
| Molecular Formula | C16H17FIN3O4 |
| CAS# | 869357-68-6 |
| SMILES | CC1=CC(=C(N(C1=O)C)NC2=C(C=C(C=C2)I)F)C(=O)NOCCO |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/azd8330.html |
