AZD1152-HQPA 100mg
AZD 1152-HQPA is a highly potent and selective inhibitor of Aurora B, with Ki values to be 0.36 (Aurora B) and 1369 nM (Aurora A) respectively and has a high specificity versus a panel of 50 other kinases.
| Trivial name | AZD1152-HQPA 100mg |
| Catalog Number | A10109-100 |
| Alternative Name(s) | 5-[[7-[3-[Ethyl(2-hydroxyethyl)amino]propoxy]-4-quinazolinyl]amino]-N-(3-fluorophenyl)-1H-pyrazole-3-acetamide |
| Molecular Formula | C26H30FN7O3 |
| CAS# | 722544-51-6 |
| SMILES | CCN(CCCOC1=CC2=C(C=C1)C(=NC=N2)NC3=NNC(=C3)CC(=O)NC4=CC(=CC=C4)F)CCO |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/azd1152-hqpa-barasertib.html |
