Asenapine maleate 25mg
Asenapine shows high affinity (pKi) for numerous receptors, including the serotonin 5-HT1A (8.6), 5-HT1B (8.4), 5-HT2A (10.2), 5-HT2B (9.8), 5-HT2C (10.5), 5-HT5A (8.8), 5-HT6 (9.5), and 5-HT7 (9.9) receptors, the adrenergic ??1 (8.9), ??2A (8.9), ??2B (9.5), and ??2C (8.9) receptors, the dopamine D1 (8.9), D2 (8.9), D3 (9.4), and D4 (9.0) receptors, and the histamine H1 (9.0) and H2 (8.2) receptors.
| Trivial name | Asenapine maleate 25mg |
| Catalog Number | A10091-25 |
| Alternative Name(s) | trans-5-Chloro-2,3,3a,12b-tetrahydro-2-methyl-1H-dibenz[2,3:6,7]oxepino[4,5-c]pyrrole maleate |
| Molecular Formula | C17H16ClNO.C4H4O4 |
| CAS# | 85650-56-2 |
| SMILES | CN1C[C@H]2[C@H](C1)C3=C(C=CC(=C3)Cl)OC4=CC=CC=C24.C(=CC(=O)O)C(=O)O |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/asenapine-maleate.html |