Anastrozole 10mM * 1mL in DMSO
Anastrozole binds reversibly to the aromatase enzyme through competitive inhibition, inhibits the conversion of androgens to estrogens in peripheral tissues (outside the CNS), and a few CNS sites in various regions within the brain. The severity of breast cancer is increased by estrogen, as sex hormones cause hyperplasia, and differentiation at estrogen receptor sites. Anastrozole works by inhibiting the synthesis of estrogen.
Trivial name | Anastrozole 10mM * 1mL in DMSO |
Catalog Number | A10075-10mM-D |
Alternative Name(s) | 2,2'-[5-(1H-1,2,4-triazol-1-ylmethyl)-1,3-phenylene]bis(2-methylpropanenitrile) |
Molecular Formula | C17H19N5 |
CAS# | 120511-73-1 |
SMILES | CC(C)(C#N)C1=CC(=CC(=C1)CN2C=NC=N2)C(C)(C)C#N |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/anastrozole.html |