Amygdalin 10mM * 1mL in DMSO
Amygdalin is a glycoside initially isolated from the seeds of the tree Prunus dulcis. Amygdalin induces apoptosis through regulation of Bax and Bcl-2 expressions in human DU145 and LNCaP prostate cancer cells.
| Trivial name | Amygdalin 10mM * 1mL in DMSO |
| Catalog Number | A10074-10mM-D |
| Alternative Name(s) | [(6-O-??-D-glucopyranosyl-??-D-glucopyranosyl)oxy](phenyl)acetonitrile |
| Molecular Formula | C20H27NO11 |
| CAS# | 29883-15-6 |
| SMILES | C1=CC=C(C=C1)[C@H](C#N)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/amygdalin.html |