Amphotericin B 100mg
Amphotericin B is a polyene antifungal antibiotic from Streptomyces sp. Amphotericin B induces K+ leakage, which is separate from its lethal action, as was demonstrated in human erythrocytes and is due to the inhibitory effect on the Na+/K+ pump.
Trivial name | Amphotericin B 100mg |
Catalog Number | A10073-100 |
Alternative Name(s) | 33-[(3-Amino-3,6-dideoxy-beta-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-Dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid |
Molecular Formula | C47H73NO17 |
CAS# | 1397-89-3 |
SMILES | C[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](CC(=O)O[C@H]([C@@H]([C@@H]1O)C)C)O)O)O)O)O)O)O)C(=O)O)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)C)O)N)O |
Size | 100mg |
Supplier Page | http://www.adooq.com/amphotericin-b.html |