Amorolfine Hydrochloride 50mg
Amorolfine hydrochloride, is a morpholine antifungal reagent that inhibits D14 reductase and D7-D8 isomerase, which depletes ergosterol and causes ignosterol to accumulate in the fungal cytoplasmic cell membranes.
Trivial name | Amorolfine Hydrochloride 50mg |
Catalog Number | A10072-50 |
Alternative Name(s) | (+/-)-cis-2,6-Dimethyl-4-[2-methyl-3-(p-tert-pentylphenyl)propyl]morpholine hydrochloride |
Molecular Formula | C₂₁H₃₆ClNO |
CAS# | 78613-38-4 |
SMILES | CCC(C)(C)C1=CC=C(C=C1)CC(C)CN2C[C@H](O[C@H](C2)C)C.Cl |
Size | 50mg |
Supplier Page | http://www.adooq.com/amorolfine-hydrochloride.html |