Amonafide 10mg
Amonafide is a DNA intercalator and topoisomerase II inhibitor for the treatment of neoplastic diseases, one of Antitumor agent.
| Trivial name | Amonafide 10mg |
| Catalog Number | A10071-10 |
| Alternative Name(s) | 5-amino-2-[2-(dimethylamino)ethyl]-1H-benzo[de]isoquinoline-1,3(2H)-dione |
| Molecular Formula | C16H17N3O2 |
| CAS# | 69408-81-7 |
| SMILES | CN(C)CCN1C(=O)C2=CC=CC3=CC(=CC(=C32)C1=O)N |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/amonafide.html |
