Amlodipine besylate 200mg
Amlodipine-besylate is L-type calcium channel blocker that displays antihypertensive properties. It inhibits Ca2+-induced contractions in depolarized rat aorta (IC50 = 1.9 nM) and displays vasoprotective effects in cardiovascular disease.
| Trivial name | Amlodipine besylate 200mg |
| Catalog Number | A10069-200 |
| Alternative Name(s) | 2-[(2-Aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-3,5-pyridinedicarboxylic acid 3-ethyl 5-methyl ester benzenesulfonate |
| Molecular Formula | C20H25ClN2O5.C6H6O3S |
| CAS# | 111470-99-6 |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OC)C)COCCN.C1=CC=C(C=C1)S(=O)(=O)O |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/amlodipine-besylate-norvasc.html |
