Altretamine 10mM * 1mL in DMSO
Altretamine is classified as an alkylating antineoplastic agent.This unique structure is believed to damage tumor cells through the production of the weakly alkylating species formaldehyde, a product of CYP450-mediated N-demethylation.
| Trivial name | Altretamine 10mM * 1mL in DMSO |
| Catalog Number | A10059-10mM-D |
| Alternative Name(s) | N2,N2,N4,N4,N6,N6-hexamethyl-1,3,5-triazine-2,4,6-triamine |
| Molecular Formula | C9H18N6 |
| CAS# | 645-05-6 |
| SMILES | CN(C)C1=NC(=NC(=N1)N(C)C)N(C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/altretamine.html |
