Aloin 10mM * 1mL in DMSO
Aloin (Barbaloin) is a yellow crystalline substance obtained from aloe and is reported to be a potent inhibitors of tyrosinase.
| Trivial name | Aloin 10mM * 1mL in DMSO |
| Catalog Number | A10058-10mM-D |
| Alternative Name(s) | (10S)-10-Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone |
| Molecular Formula | C21H22O9 |
| CAS# | 1415-73-2 |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(C=C(C=C3[C@@H]2[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)CO)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/aloin-barbaloin.html |