Allopurinol sodium 100mg
Allopurinol is a structural isomer of hypoxanthine (a naturally occurring purine in the body) and is an inhibitor of the enzyme xanthine oxidase.
| Trivial name | Allopurinol sodium 100mg |
| Catalog Number | A10056-100 |
| Alternative Name(s) | 1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one, monosodium salt |
| Molecular Formula | C5H4N4NaO |
| CAS# | 17795-21-0 |
| SMILES | C1=NNC2=C1C(=NC=N2)[O-].[Na+] |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/allopurinol-sodium.html |
