Alfuzosin HCl 100mg
Alfuzosin (provided as the hydrochloride salt) is an ??1 receptor antagonist used to treat benign prostatic hyperplasia (BPH). It works by relaxing the muscles in the prostate and bladder neck, making it easier to urinate.
| Trivial name | Alfuzosin HCl 100mg |
| Catalog Number | A10052-100 |
| Alternative Name(s) | N-[3-[(4-amino-6,7-dimethoxy-quinazolin-2-yl)- methyl-amino]propyl] tetrahydrofuran- 2-carboxamide hydrochloride |
| Molecular Formula | C19H27N5O4.HCl |
| CAS# | 81403-68-1 |
| SMILES | CN(CCCNC(=O)C1CCCO1)C2=NC3=CC(=C(C=C3C(=N2)N)OC)OC.Cl |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/alfuzosin-hcl.html |
