Alfacalcidol 10mg
Alfacalcidol is an analogue of vitamin D.Alfacalcidol has a weaker impact on calcium metabolism than calcitriol, while having more potent effects on parathyroid hormone levels and the immune system, including regulatory T cells.
| Trivial name | Alfacalcidol 10mg |
| Catalog Number | A10051-10 |
| Alternative Name(s) | (1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-7a-Methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| Molecular Formula | N/A |
| CAS# | 41294-56-8 |
| SMILES | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CCC/C2=CC=C/3C[C@H](C[C@@H](C3=C)O)O)C |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/alfacalcidol.html |
