AG-490 10mM * 1mL in DMSO
AG 490 is a selective inhibitor of EGF receptor tyrosine kinase (IC50 values are 2 and 13.5 uM for EGFR and ErbB2 respectively).
Trivial name | AG-490 10mM * 1mL in DMSO |
Catalog Number | A10047-10mM-D |
Alternative Name(s) | (E)-2-Cyano-3-(3,4-dihydrophenyl)-N-(phenylmethyl)-2-propenamide |
Molecular Formula | C17H14N2O3 |
CAS# | 133550-30-8 |
SMILES | C1=CC=C(C=C1)CNC(=O)/C(=C/C2=CC(=C(C=C2)O)O)/C#N |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/ag-490.html |