Aesculin 200mg
Aesculin is a glucoside that naturally occurs in the horse chestnut (Aesculus hippocastanum). It is used in a microbiology laboratory to aid in the identification of bacterial species (especially Enterococci and Listeria).
| Trivial name | Aesculin 200mg |
| Catalog Number | A10044-200 |
| Alternative Name(s) | 7-hydroxy-6-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy- 6-(hydroxymethyl)-2-tetrahydropyranyl]oxy}-2-chromenone |
| Molecular Formula | C15H16O9 |
| CAS# | 531-75-9 |
| SMILES | C1=CC(=O)OC2=CC(=C(C=C21)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/aesculin-esculin.html |
