Acadesine 200mg
Acadesine is a selective activator of AMPK in both hepatocytes and adipocytes.
| Trivial name | Acadesine 200mg |
| Catalog Number | A10028-200 |
| Alternative Name(s) | 5-?€?amino-?€?1-?€???-?€?D-?€?ribofuranosyl-?€?1H-?€?imidazole-?€?4-?€?carboxamide |
| Molecular Formula | C9H14N4O5 |
| CAS# | 2627-69-2 |
| SMILES | C1=NC(=C(N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N)C(=O)N |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/acadesine.html |
