Linifanib (ABT-869) 50mg
Linifanib (ABT-869) is a structurally novel, potent inhibitor of RTK, VEGF and PDGF with IC50 of 0.2, 2, 4, and 7 nM for human endothelial cells, PDGFR-??, KDR, and CSF-1R, respectively.
| Trivial name | Linifanib (ABT-869) 50mg |
| Catalog Number | A10025-50 |
| Alternative Name(s) | N-?€?[4-?€?(3-?€?amino-?€?1H-?€?indazol-?€?4-?€?yl)phenyl]-?€?N?€?-?€?(2-?€?fluoro-?€?5-?€?methylphenyl)-?€?urea |
| Molecular Formula | C21H18FN5O |
| CAS# | 796967-16-3 |
| SMILES | CC1=CC(=C(C=C1)F)NC(=O)NC2=CC=C(C=C2)C3=C4C(=CC=C3)NN=C4N |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/linifanib-abt-869.html |