5-hydroxytryptophan 100mg
5-Hydroxytryptophan (5-HTP) is a naturally occurring amino acid and chemical precursor as well as a metabolic intermediate in the biosynthesis of the neurotransmitters serotonin and melatonin from tryptophan.
| Trivial name | 5-hydroxytryptophan 100mg |
| Catalog Number | A10017-100 |
| Alternative Name(s) | 2-amino-3- (5-hydroxy-1H-indol-3-yl) propanoic acid |
| Molecular Formula | C11H12N2O3 |
| CAS# | 56-69-9 |
| SMILES | C1=CC2=C(C=C1O)C(=CN2)CC(C(=O)O)N |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/5-hydroxytryptophan-5-htp.html |