2-Methoxyestradiol 50mg
2-Methoxyestradiol is an apoptotic, antiproliferative and antiangiogenic agent. Induces p53-induced apoptosis via two pathways: activation of p38 and NF-??B; and activation of JNK and AP-1 leading to Bcl-2 phosphorylation.
| Trivial name | 2-Methoxyestradiol 50mg |
| Catalog Number | A10012-50 |
| Alternative Name(s) | (17??)-2-Methoxyestra-1,3,5(10)-trien e-3,17-diol |
| Molecular Formula | C19H26O3 |
| CAS# | 362-07-2 |
| SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C(OC)=C3 |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/2-methoxyestradiol.html |
