17-DMAG HCl 200mg
17-DMAG is a water-soluble analog of 17-AAG and geldanamycin that binds the ATP binding site of Hsp90 and inhibits its chaperone activity. Displays more potent antitumor activity than 17-AAG.
| Trivial name | 17-DMAG HCl 200mg |
| Catalog Number | A10011-200 |
| Alternative Name(s) | 17-Demethoxy-17-[[2-(dimethylamino) ethyl]amino]geldanamycin hydrochloride |
| Molecular Formula | C32H48N4O8.HCl |
| CAS# | 467214-21-7 |
| SMILES | CC1CC(C(C(C=C(C(C(C=CC=C(C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCCN(C)C)C)OC)OC(=O)N)C)C)O)OC.Cl |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/17-dmag-hcl-alvespimycin.html |
