Sorafenib (Nexavar) 10mg
Sorafenib (Nexavar) is a novel, small molecular inhibitor of several tyrosine protein kinases (VEGFR and PDGFR) and RAF/MEK/ERK cascade inhibitor with an IC50 of 6, 22, 38 nM for Raf-1, wt BRAF and V599E mutant BRAF.
| Trivial name | Sorafenib (Nexavar) 10mg |
| Catalog Number | A10001-10 |
| Alternative Name(s) | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methyl-pyridine-2-carboxamide |
| Molecular Formula | C21H16ClF3N4O3.C7H8O3S |
| CAS# | 475207-59-1 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/sorafenib-nexavar.html |
