Tranylcypromine HCl
Tranylcypromine HCl is a monoamine oxidase inhibitor, which inhibits CYP2A6 with Ki of 0.08 μM and 0.2 μM in cDNA-expressing microsomes and Human Liver Microsomes, respectively.
| Trivial name | 2-PCPA HCl, SKF-385 HCl |
| Catalog Number | S4246 |
| Molecular Formula | C27H33F2N7O2 |
| CAS# | 1986-47-6 |
| SMILES | CNC(=O)N1CCC2=C(C1)C(=N[N]2C3CCOCC3)N4CCCC5=C4C=C(C(F)F)C(=C5)C6=C[N](C)N=C6 |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/tranylcypromine-2-pcpa-hcl.html |
| Additional Information | https://file.selleck.cn/downloads/struct/tranylcypromine-2-pcpa-hcl-chemical-structure-s4246.gif |