Minocycline HCl
Minocycline HCl is the most lipid soluble and most active tetracycline antibiotic, binds to the 30S ribosomal subunit, preventing the binding of tRNA to the mRNA-ribosome complex and interfering with protein synthesis.
| Trivial name | CL 59806 |
| Catalog Number | S4226 |
| Molecular Formula | C12H9FN2O2 |
| CAS# | 13614-98-7 |
| Inchi | InChI=1S/C12H9FN2O2/c13-6-1-2-10-7(3-6)9(5-14-10)8-4-11(16)15-12(8)17/h1-3,5,8,14H,4H2,(H,15,16,17) |
| Inchi Key | MXKLDYKORJEOPR-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC1=O)C2=CNC3=C2C=C(C=C3)F |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/minocycline-hcl.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s4226-minocycline-cl-59806-hcl-chemical-structure.png |
