L-Arginine HCl (L-Arg)
L-Arginine(L-Arg,(S)-(+)-Arginine hydrochloride) is the nitrogen donor for synthesis of nitric oxide, a potent vasodilator that is deficient during times of sickle cell crisis.L-Arginine HCl (L-Arg) can be used to induce animal models of Acute Pancreatitis.
| Trivial name | (S)-(+)-Arginine hydrochloride |
| Catalog Number | S3174 |
| Molecular Formula | C18H14N2O4 |
| CAS# | 1119-34-2 |
| Inchi | InChI=1S/C18H14N2O4/c21-15-6-5-11(7-17(15)23)10-19-20-18(24)14-8-12-3-1-2-4-13(12)9-16(14)22/h1-10,21-23H,(H,20,24)/b19-10+ |
| Inchi Key | SYNDQCRDGGCQRZ-VXLYETTFSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)NN=CC3=CC(=C(C=C3)O)O)O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/l-Arginine-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/L-Arginine-hydrochloride-chemical-structure-s3174.gif |