Tyrphostin 9
Tyrphostin 9 (SF 6847, RG-50872) is firstly designed as an EGFR inhibitor with IC50 of 460 μM, but is also found to be more potent to PDGFR with IC50 of 0.5 μM.
| Trivial name | SF 6847, RG-50872 |
| Catalog Number | S2895 |
| Molecular Formula | C21H18F2N2O2 |
| CAS# | 10537-47-0 |
| Inchi | InChI=1S/C21H18F2N2O2/c22-19-11-15(12-20(23)21(19)26)18-13-24-6-5-17(18)14-1-3-16(4-2-14)25-7-9-27-10-8-25/h1-6,11-13,26H,7-10H2 |
| Inchi Key | YUYJEQHNWKQNBT-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=C(C=C2)C3=C(C=NC=C3)C4=CC(=C(C(=C4)F)O)F |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/tyrphostin-9-sf-6847.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Tyrphostin-9-chemical-structure-s2895.jpg |
