PF-562271 Besylate
PF-562271 Besylate is the benzenesulfonate salt of PF-562271, which is a potent, ATP-competitive, reversible inhibitor of FAK with IC50 of 1.5 nM, ~10-fold less potent for Pyk2 than FAK and >100-fold selectivity against other protein kinases, except for some CDKs. Phase 1.
| Trivial name | PF-00562271 Besylate |
| Catalog Number | S2672 |
| Molecular Formula | C25H19N5S |
| CAS# | 939791-38-5 |
| SMILES | CC1=NC(=CC=C1)C2=NN(C=C2C3=CC=NC4=CC=CC=C34)C(=S)NC5=CC=CC=C5 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/pf-00562271.html |
| Additional Information | https://file.selleck.cn/downloads/struct/PF-00562271-chemical-structure-s2672.gif |