Loperamide HCl
Loperamide HCl (ADL 2-1294,R-18553 hydrochloride) is a selective μ-opioid receptor agonist opioid with Ki of 3.3 nM, 15-fold and 350-fold selective over the δ subtype and the κ subtype of the opioid receptor, used against diarrhea resulting from gastroenteritis or inflammatory bowel disease.
| Trivial name | ADL 2-1294,R-18553 hydrochloride |
| Catalog Number | S2480 |
| Molecular Formula | C21H18ClFN6O2 |
| CAS# | 34552-83-5 |
| Inchi | InChI=1S/C21H18ClFN6O2/c1-28-19(5-8-25-28)27-21-24-7-4-17(26-21)13-6-9-29(20(31)11-13)18(12-30)14-2-3-15(22)16(23)10-14/h2-11,18,30H,12H2,1H3,(H,24,26,27)/t18-/m1/s1 |
| Inchi Key | RZUOCXOYPYGSKL-GOSISDBHSA-N |
| SMILES | CN1C(=CC=N1)NC2=NC=CC(=N2)C3=CC(=O)N(C=C3)C(CO)C4=CC(=C(C=C4)Cl)F |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/Loperamide-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Loperamide-hydrochloride-chemical-structure-S2480.gif |