Dyclonine HCl
Dyclonine HCl(Dyclocaine HCl) is a hydrochloride salt form of dyclonine which is an oral anaesthetic, reversibly binds to activated sodium channels on the neuronal membrane, thereby decreasing the neuronal membrane’s permeability to sodium ions, leading to an increased threshold for excitation.
| Trivial name | Dyclocaine HCl |
| Catalog Number | S2041 |
| Molecular Formula | C15H15NO |
| CAS# | 536-43-6 |
| Inchi | InChI=1S/C15H15NO/c16-15-9-14(15)11-6-4-10(5-7-11)12-2-1-3-13(17)8-12/h1-8,14-15,17H,9,16H2/t14-,15+/m1/s1 |
| Inchi Key | DSOJSZXQRJGBCW-CABCVRRESA-N |
| SMILES | C1C(C1N)C2=CC=C(C=C2)C3=CC(=CC=C3)O |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/dyclonine-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Dyclonine-hydrochloride--chemical-structure-s2041.gif |
