SRT1720 HCl
SRT1720 HCl is a selective SIRT1 activator with EC50 of 0.16 μM in a cell-free assay, but is >230-fold less potent for SIRT2 and SIRT3. SRT1720 induces autophagy.
| Trivial name | N/A |
| Catalog Number | S1129 |
| Molecular Formula | C16H19Cl2N5 |
| CAS# | 1001645-58-4 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1(N)CCN(CC1)C2=CN=C(C(=N2)N)C3=C(Cl)C(=CC=C3)Cl |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/SRT1720.html |
| Additional Information | https://file.selleck.cn/downloads/struct/SRT1720-chemical-structure-s1129.gif |