Iniparib (BSI-201)
Iniparib (BSI-201, NSC-746045, IND-71677) is a PARP1 inhibitor with demonstrated effectiveness in triple-negative breast cancer (TNBC). Phase 3.
| Trivial name | NSC-746045, IND-71677 |
| Catalog Number | S1087 |
| Molecular Formula | C5H9NO4 |
| CAS# | 160003-66-7 |
| Inchi | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1 |
| Inchi Key | WHUUTDBJXJRKMK-VKHMYHEASA-N |
| SMILES | C(CC(=O)O)C(C(=O)O)N |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/BSI-201.html |
| Additional Information | https://file.selleck.cn/downloads/struct/BSI-201-chemical-structure-S1087.gif |
