PD153035 HCl
PD153035 HCl (SU-5271 HCl, AG1517 HCl, ZM 252868 HCl) is a potent and specific inhibitor of EGFR with Ki and IC50 of 5.2 pM and 29 pM in cell-free assays; little effect noted against PGDFR, FGFR, CSF-1, InsR and Src.
| Trivial name | SU-5271 (AG1517) HCl ,ZM 252868 HCl |
| Catalog Number | S1079 |
| Molecular Formula | C6H5NO3 |
| CAS# | 183322-45-4 |
| Inchi | InChI=1S/C6H5NO3/c8-4-2-1-3-7-5(4)6(9)10/h1-3,8H,(H,9,10) |
| Inchi Key | BRARRAHGNDUELT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=O)O)O |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/PD-153035-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/PD153035-chemical-structure-S1079.gif |