PD153035 HCl
PD153035 HCl (SU-5271 HCl, AG1517 HCl, ZM 252868 HCl) is a potent and specific inhibitor of EGFR with Ki and IC50 of 5.2 pM and 29 pM in cell-free assays; little effect noted against PGDFR, FGFR, CSF-1, InsR and Src.
| Trivial name | SU-5271 (AG1517) HCl ,ZM 252868 HCl |
| Catalog Number | S1079 |
| Molecular Formula | C16H14BrN3O2.HCl |
| CAS# | 183322-45-4 |
| Inchi | InChI=1S/C16H14BrN3O2.ClH/c1-21-14-7-12-13(8-15(14)22-2)18-9-19-16(12)20-11-5-3-4-10(17)6-11;/h3-9H,1-2H3,(H,18,19,20);1H |
| Inchi Key | ZJOKWAWPAPMNIM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=CC=C3)Br)OC.Cl |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/PD-153035-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/PD153035-chemical-structure-S1079.gif |