Pictilisib (GDC-0941)
Pictilisib (GDC-0941, RG7321) is a potent inhibitor of PI3Kα/δ with IC50 of 3 nM in cell-free assays, with modest selectivity against p110β (11-fold) and p110γ (25-fold). Pictilisib (GDC-0941) induces autophagy and apoptosis. Phase 2.
| Trivial name | RG7321 |
| Catalog Number | S1065 |
| Molecular Formula | C16H23Cl2N3O2S |
| CAS# | 957054-30-7 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | Cl.Cl.CC1CNCCCN1[S](=O)(=O)C2=CC=CC3=C2C(=CN=C3)C |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/GDC-0941.html |
| Additional Information | https://file.selleck.cn/downloads/struct/GDC-0941-chemical-structure-S1065.gif |
