Lenalidomide
Lenalidomide is a TNF-α secretion inhibitor with IC50 of 13 nM in PBMCs. Lenalidomide (CC-5013) is a ligand of ubiquitin E3 ligase cereblon (CRBN), and it causes selective ubiquitination and degradation of two lymphoid transcription factors, IKZF1 and IKZF3, by the CRBN-CRL4 ubiquitin ligase. Lenalidomide promotes cleaved caspase-3 expression and inhibit VEGF expression and induces apoptosis.
| Trivial name | CC-5013 |
| Catalog Number | S1029 |
| Molecular Formula | C5H7ClN2O2 |
| CAS# | 191732-72-6 |
| Inchi | InChI=1S/C5H6N2O2.ClH/c8-5(9)1-4-2-6-3-7-4;/h2-3H,1H2,(H,6,7)(H,8,9);1H |
| Inchi Key | MWHLCFYPFGFBQO-UHFFFAOYSA-N |
| SMILES | C1=C(NC=N1)CC(=O)O.Cl |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/lenalidomide-s1029.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Lenalidomide-chemical-structure-S1029.gif |