Ridaforolimus (Deforolimus, MK-8669)
Ridaforolimus (Deforolimus, MK-8669, AP23573) is a selective mTOR inhibitor with IC50 of 0.2 nM in HT-1080 cell line; while not classified as a prodrug, mTOR inhibition and FKBP12 binding is similar to rapamycin. Phase 3.
| Trivial name | AP23573 |
| Catalog Number | S1022 |
| Molecular Formula | C15H11Cl2NO4 |
| CAS# | 572924-54-0 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | OC(=O)C1=C(NC(=O)COC2=CC=CC=C2Cl)C=C(Cl)C=C1 |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/Deforolimus.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Deforolimus-Ridaforolimus-chemical-structure-S1022.gif |