PD184352 (CI-1040)
PD184352 (CI-1040) is an ATP non-competitive MEK1/2 inhibitor with IC50 of 17 nM in cell-based assays, 100-fold more selective for MEK1/2 than MEK5. PD184352 (CI-1040) selectively induces apoptosis.
| Trivial name | N/A |
| Catalog Number | S1020 |
| Molecular Formula | C19H20N6OS |
| CAS# | 212631-79-3 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CN1CCN(CC1)C2=CC=C3N=C([NH]C3=C2)C4=C(N)C5=C(NC4=O)SC=C5 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/CI-1040-(PD184352).html |
| Additional Information | https://file.selleck.cn/downloads/struct/CI-1040-PD184352-chemical-structure-S1020.gif |
