Mirdametinib (PD0325901)
Mirdametinib (PD0325901) is a selective and non ATP-competitive MEK inhibitor with IC50 of 0.33 nM in cell-free assays, roughly 500-fold more potent than CI-1040 on phosphorylation of ERK1 and ERK2. Phase 2.
| Trivial name | N/A |
| Catalog Number | S1036 |
| Molecular Formula | C8H10NO6P.xH2O |
| CAS# | 391210-10-9 |
| SMILES | CC1=NC=C(C(=C1O)C=O)COP(=O)(O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/PD-0325901.html |
| Additional Information | https://file.selleck.cn/downloads/struct/PD0325901-chemical-structure-S1036.gif |