E3 ligase Ligand 2
E3 ligase Ligand 2 is a thalidomide derivate for conjugation reactions of PROTAC, which can hijack cereblon as the E3 ubiquitin ligase component.
| Trivial name | 4-Hydroxy Thalidomide |
| Catalog Number | CSN21420 |
| Alternative Name(s) | 4-Hydroxy Thalidomide |
| Research Area | / |
| Molecular Formula | C13H10N2O5 |
| CAS# | 5054-59-1 |
| Purity | ≥99% |
| SMILES | O=C1N(C(CC2)C(NC2=O)=O)C(C3=C1C=CC=C3O)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/e3-ligase-ligand-2.html |