Lixivaptan
Lixivaptan is an orally active and selective vasopressin receptor V2 antagonist with IC50 values of 1.2 and 2.3 nM for human and rat V2, respectively.
| Trivial name | VPA-985, WAY-VPA 985 |
| Catalog Number | CSN21908 |
| Alternative Name(s) | VPA-985, WAY-VPA 985 |
| Research Area | / |
| Molecular Formula | C27H21ClFN3O2 |
| CAS# | 168079-32-1 |
| Purity | ≥99% |
| SMILES | O=C(NC1=CC=C(C(N2CC3=CC=CN3CC4=CC=CC=C24)=O)C(Cl)=C1)C5=CC(F)=CC=C5C |
| Size | 2mg |
| Supplier Page | https://www.csnpharm.com/products/lixivaptan.html |