T-1101 tosylate
T-1101 tosylate is a Hec1/Nek2 (Highly expressed in cancer 1 / NIMA-related kinase 2) inhibitor with antitumor activity. T-1101 tosylate is inactive toward normal cells, kinases and hERG.
| Trivial name | TAI-95 tosylate |
| Catalog Number | CSN25544 |
| Alternative Name(s) | TAI-95 tosylate |
| Research Area | Cancer |
| Molecular Formula | C31H31N5O6S3 |
| CAS# | 2250404-95-4 |
| Purity | ≥99% |
| SMILES | O=C(C1=CC=NC=C1)NC2=NC(C3=C(C)C=C(SC4=NC=C(OCCOC)N=C4)C=C3C)=CS2.CC5=CC=C(S(O)(=O)=O)C=C5 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/t-1101-tosylate.html |