L-765314
L-765314 is a potent and selective α1b adrenergic receptor antagonist with Kis of 5.4±0.6 nM and 2.0±0.66 nM for rat and human α1b adrenergic receptor, respectively.
| Trivial name | A-322312 |
| Catalog Number | CSN22444 |
| Alternative Name(s) | A-322312 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C27H34N6O5 |
| CAS# | 189349-50-6 |
| Purity | ≥99% |
| SMILES | O=C(N1[C@H](C(NC(C)(C)C)=O)CN(C2=NC(N)=C3C=C(OC)C(OC)=CC3=N2)CC1)OCC4=CC=CC=C4 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/l-765314.html |