Cidofovir
Cidofovir is an anti-CMV drug which can suppress CMV replication by selective inhibition of viral DNA polymerase and therefore prevention of viral replication and transcription.
| Trivial name | HPMPC; GS 0504 |
| Catalog Number | CSN10636 |
| Alternative Name(s) | HPMPC; GS 0504 |
| Research Area | Infection |
| Molecular Formula | C8H14N3O6P |
| CAS# | 113852-37-2 |
| Purity | ≥99% |
| SMILES | OC[C@@H](OCP(O)(O)=O)CN1C=CC(N)=NC1=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/cidofovir.html |