RIN1
RIN1 is a new class of small molecule inhibitor that disrupts the interaction between NOTCH and RBPJ. It also blocked the functional interaction of RBPJ with SHARP, a scaffold protein that forms a transcriptional repressor complex with RBPJ in the absence of NOTCH signaling.
| Trivial name | RBPJ INhibitor-1 |
| Catalog Number | CSN27582 |
| Alternative Name(s) | RBPJ INhibitor-1 |
| Research Area | / |
| Molecular Formula | C17H14FN3O2 |
| CAS# | N/A |
| Purity | ≥99% |
| SMILES | FC1=CC=CC=C1OC2=C(C(N)=O)C=CC(C3=CC=NN3C)=C2 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/rin1.html |