Tubulin inhibitor 6
Tubulin inhibitor 6 (Compound 14b) is a tubulin inhibitor and a potent inhibitor of multiple cancer cell lines. Tubulin inhibitor 6 inhibits tubulin polymerization with an IC50 of 0.87 μM. Tubulin inhibitor 6 inhibits K562 cell growth with an IC50 of 840 nM[1].
| Trivial name | / |
| Catalog Number | CSN26703 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C20H14ClNO2S |
| CAS# | 105925-39-1 |
| Purity | ≥99% |
| SMILES | O=C(N1C2=C(C=CC=C2)SC3=CC=C(Cl)C=C13)C4=CC=C(OC)C=C4 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/(2-chloro-10h-phenothiazin-10-yl)(4-methoxyphenyl)methanone.html |