Syringaldehyde
Syringaldehyde is a polyphenolic compound belonging to the group of flavonoids and is found in different plant species like Manihot esculenta and Magnolia officinalis. Syringaldehyde moderately inhibits COX-2 activity with an IC50 of 3.5 μg/mL. Anti-hyperglycemic and anti-inflammatory activities.
| Trivial name | / |
| Catalog Number | CSN24972 |
| Alternative Name(s) | / |
| Research Area | Metabolic Disease|Immunology/Inflammation |
| Molecular Formula | C9H10O4 |
| CAS# | 134-96-3 |
| Purity | ≥99% |
| SMILES | O=CC1=CC(OC)=C(O)C(OC)=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/syringaldehyde.html |